C32H36N2O5 — CID 139845756
ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methylidene]-4-oxobutanoate (PubChem CID 139845756) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methylidene]-4-oxobutanoate.
| Compound Name | ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methylidene]-4-oxobutanoate |
|---|---|
| PubChem CID | 139845756 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methylidene]-4-oxobutanoate |
| SMILES | CCOC(=O)/C(=C/c1ccc(OCc2nc(-c3ccccc3)oc2C)cc1)CC(=O)N1C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C32H36N2O5/c1-3-37-32(36)27(18-30(35)34-19-25-11-7-8-12-26(25)20-34)17-23-13-15-28(16-14-23)38-21-29-22(2)39-31(33-29)24-9-5-4-6-10-24/h4-6,9-10,13-17,25-26H,3,7-8,11-12,18-21H2,1-2H3/b27-17+/t25-,26+ |
| InChIKey | LJKNTBIORWGWKK-NGGAPEAQSA-N |
| XLogP | 6.21 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|