C32H40N2O5 — CID 139845719
ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[4-(benzylamino)-4-oxobutoxy]phenyl]methylidene]-4-oxobutanoate (PubChem CID 139845719) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[4-(benzylamino)-4-oxobutoxy]phenyl]methylidene]-4-oxobutanoate.
| Compound Name | ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[4-(benzylamino)-4-oxobutoxy]phenyl]methylidene]-4-oxobutanoate |
|---|---|
| PubChem CID | 139845719 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[4-(benzylamino)-4-oxobutoxy]phenyl]methylidene]-4-oxobutanoate |
| SMILES | CCOC(=O)/C(=C/c1ccc(OCCCC(=O)NCc2ccccc2)cc1)CC(=O)N1C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C32H40N2O5/c1-2-38-32(37)28(20-31(36)34-22-26-11-6-7-12-27(26)23-34)19-24-14-16-29(17-15-24)39-18-8-13-30(35)33-21-25-9-4-3-5-10-25/h3-5,9-10,14-17,19,26-27H,2,6-8,11-13,18,20-23H2,1H3,(H,33,35)/b28-19+/t26-,27+ |
| InChIKey | IIHYEVYZQGVCHN-CGGHZWGVSA-N |
| XLogP | 5.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|