C34H39ClN2O5 — CID 139845724
ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[3-[4-(4-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propoxy]phenyl]methylidene]-4-oxobutanoate (PubChem CID 139845724) has the molecular formula C34H39ClN2O5 and a molecular weight of 591.15 g/mol. Its IUPAC name is ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[3-[4-(4-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propoxy]phenyl]methylidene]-4-oxobutanoate.
| Compound Name | ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[3-[4-(4-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propoxy]phenyl]methylidene]-4-oxobutanoate |
|---|---|
| PubChem CID | 139845724 |
| Molecular Formula | C34H39ClN2O5 |
| Molecular Weight | 591.15 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | ethyl (2E)-4-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[3-[4-(4-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propoxy]phenyl]methylidene]-4-oxobutanoate |
| SMILES | CCOC(=O)/C(=C/c1ccc(OCCCc2oc(C)nc2-c2ccc(Cl)cc2)cc1)CC(=O)N1C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C34H39ClN2O5/c1-3-40-34(39)28(20-32(38)37-21-26-7-4-5-8-27(26)22-37)19-24-10-16-30(17-11-24)41-18-6-9-31-33(36-23(2)42-31)25-12-14-29(35)15-13-25/h10-17,19,26-27H,3-9,18,20-22H2,1-2H3/b28-19+/t26-,27+ |
| InChIKey | ZEKPVNAIMZSLCH-CGGHZWGVSA-N |
| XLogP | 7.30 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.15 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|