C22H22F2 — CID 139849251
6-but-3-enyl-2-(4-ethenyl-2,6-difluorophenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139849251) has the molecular formula C22H22F2 and a molecular weight of 324.41 g/mol. Its IUPAC name is 6-but-3-enyl-2-(4-ethenyl-2,6-difluorophenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-but-3-enyl-2-(4-ethenyl-2,6-difluorophenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139849251 |
| Molecular Formula | C22H22F2 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 6-but-3-enyl-2-(4-ethenyl-2,6-difluorophenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CCCc1ccc2c(c1)CCC(c1c(F)cc(C=C)cc1F)C2 |
| InChI | InChI=1S/C22H22F2/c1-3-5-6-16-7-8-18-14-19(10-9-17(18)11-16)22-20(23)12-15(4-2)13-21(22)24/h3-4,7-8,11-13,19H,1-2,5-6,9-10,14H2 |
| InChIKey | IBIGLYBQKQPEHU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|