C22H21F5O — CID 139847863
2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139847863) has the molecular formula C22H21F5O and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139847863 |
| Molecular Formula | C22H21F5O |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/CCc1cc(F)c(C2CCc3cc(OC(F)(F)F)ccc3C2)c(F)c1 |
| InChI | InChI=1S/C22H21F5O/c1-2-3-4-5-14-10-19(23)21(20(24)11-14)17-7-6-16-13-18(28-22(25,26)27)9-8-15(16)12-17/h2-3,8-11,13,17H,4-7,12H2,1H3/b3-2+ |
| InChIKey | RQVQVVKEJXMXSR-NSCUHMNNSA-N |
| XLogP | 6.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|