C20H19F3 — CID 139848317
2-(4-but-3-enyl-2,6-difluorophenyl)-7-fluoro-1,2,3,4-tetrahydronaphthalene (PubChem CID 139848317) has the molecular formula C20H19F3 and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-(4-but-3-enyl-2,6-difluorophenyl)-7-fluoro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(4-but-3-enyl-2,6-difluorophenyl)-7-fluoro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139848317 |
| Molecular Formula | C20H19F3 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-(4-but-3-enyl-2,6-difluorophenyl)-7-fluoro-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CCCc1cc(F)c(C2CCc3ccc(F)cc3C2)c(F)c1 |
| InChI | InChI=1S/C20H19F3/c1-2-3-4-13-9-18(22)20(19(23)10-13)15-6-5-14-7-8-17(21)12-16(14)11-15/h2,7-10,12,15H,1,3-6,11H2 |
| InChIKey | AEWGEXKNIKWXQU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|