C21H20F4O — CID 139847963
2-(4-but-3-enylphenyl)-7-fluoro-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139847963) has the molecular formula C21H20F4O and a molecular weight of 364.38 g/mol. Its IUPAC name is 2-(4-but-3-enylphenyl)-7-fluoro-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(4-but-3-enylphenyl)-7-fluoro-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139847963 |
| Molecular Formula | C21H20F4O |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(4-but-3-enylphenyl)-7-fluoro-6-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CCCc1ccc(C2CCc3cc(OC(F)(F)F)c(F)cc3C2)cc1 |
| InChI | InChI=1S/C21H20F4O/c1-2-3-4-14-5-7-15(8-6-14)16-9-10-17-13-20(26-21(23,24)25)19(22)12-18(17)11-16/h2,5-8,12-13,16H,1,3-4,9-11H2 |
| InChIKey | MINBYABTDJCLHJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|