C15H12N2O5 — CID 139851917
4-[(3-methoxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 139851917) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is 4-[(3-methoxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[(3-methoxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 139851917 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-[(3-methoxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | COc1cccc(/N=N/c2ccc(C(=O)O)cc2C(=O)O)c1 |
| InChI | InChI=1S/C15H12N2O5/c1-22-11-4-2-3-10(8-11)16-17-13-6-5-9(14(18)19)7-12(13)15(20)21/h2-8H,1H3,(H,18,19)(H,20,21)/b17-16+ |
| InChIKey | BPFMTIGMOOOHKQ-WUKNDPDISA-N |
| XLogP | 3.51 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|