C19H16N2O4 — CID 581598
4,5-dimethoxy-2-(naphthalen-2-yldiazenyl)benzoic acid (PubChem CID 581598) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(naphthalen-2-yldiazenyl)benzoic acid.
| Compound Name | 4,5-dimethoxy-2-(naphthalen-2-yldiazenyl)benzoic acid |
|---|---|
| PubChem CID | 581598 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4,5-dimethoxy-2-(naphthalen-2-yldiazenyl)benzoic acid |
| SMILES | COc1cc(/N=N/c2ccc3ccccc3c2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C19H16N2O4/c1-24-17-10-15(19(22)23)16(11-18(17)25-2)21-20-14-8-7-12-5-3-4-6-13(12)9-14/h3-11H,1-2H3,(H,22,23)/b21-20+ |
| InChIKey | IHLKYRKTOKWIMJ-QZQOTICOSA-N |
| XLogP | 4.97 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|