C26H20F2N2O — CID 139856657
5-butoxy-2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine (PubChem CID 139856657) has the molecular formula C26H20F2N2O and a molecular weight of 414.46 g/mol. Its IUPAC name is 5-butoxy-2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine.
| Compound Name | 5-butoxy-2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 139856657 |
| Molecular Formula | C26H20F2N2O |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 5-butoxy-2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine |
| SMILES | CCCCOc1cnc(-c2ccc(C#Cc3ccc4cc(F)c(F)cc4c3)cc2)nc1 |
| InChI | InChI=1S/C26H20F2N2O/c1-2-3-12-31-23-16-29-26(30-17-23)20-9-6-18(7-10-20)4-5-19-8-11-21-14-24(27)25(28)15-22(21)13-19/h6-11,13-17H,2-3,12H2,1H3 |
| InChIKey | SEBYNEMJGYUNJW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|