C24H29F3O — CID 139861063
6-but-3-enyl-3-(difluoromethoxy)-1-fluoro-2-(4-propylcyclohexyl)naphthalene (PubChem CID 139861063) has the molecular formula C24H29F3O and a molecular weight of 390.49 g/mol. Its IUPAC name is 6-but-3-enyl-3-(difluoromethoxy)-1-fluoro-2-(4-propylcyclohexyl)naphthalene.
| Compound Name | 6-but-3-enyl-3-(difluoromethoxy)-1-fluoro-2-(4-propylcyclohexyl)naphthalene |
|---|---|
| PubChem CID | 139861063 |
| Molecular Formula | C24H29F3O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 6-but-3-enyl-3-(difluoromethoxy)-1-fluoro-2-(4-propylcyclohexyl)naphthalene |
| SMILES | C=CCCc1ccc2c(F)c(C3CCC(CCC)CC3)c(OC(F)F)cc2c1 |
| InChI | InChI=1S/C24H29F3O/c1-3-5-7-17-10-13-20-19(14-17)15-21(28-24(26)27)22(23(20)25)18-11-8-16(6-4-2)9-12-18/h3,10,13-16,18,24H,1,4-9,11-12H2,2H3 |
| InChIKey | JSEBDLIQRXRBLZ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|