C22H25F3O — CID 139862461
3-(difluoromethoxy)-6-ethenyl-1-fluoro-2-(4-propylcyclohexyl)naphthalene (PubChem CID 139862461) has the molecular formula C22H25F3O and a molecular weight of 362.44 g/mol. Its IUPAC name is 3-(difluoromethoxy)-6-ethenyl-1-fluoro-2-(4-propylcyclohexyl)naphthalene.
| Compound Name | 3-(difluoromethoxy)-6-ethenyl-1-fluoro-2-(4-propylcyclohexyl)naphthalene |
|---|---|
| PubChem CID | 139862461 |
| Molecular Formula | C22H25F3O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 3-(difluoromethoxy)-6-ethenyl-1-fluoro-2-(4-propylcyclohexyl)naphthalene |
| SMILES | C=Cc1ccc2c(F)c(C3CCC(CCC)CC3)c(OC(F)F)cc2c1 |
| InChI | InChI=1S/C22H25F3O/c1-3-5-15-6-9-16(10-7-15)20-19(26-22(24)25)13-17-12-14(4-2)8-11-18(17)21(20)23/h4,8,11-13,15-16,22H,2-3,5-7,9-10H2,1H3 |
| InChIKey | NDMCSXVKDBZMCF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |