C24H31F3O — CID 139860913
3-(difluoromethoxy)-2-(4-ethylcyclohexyl)-1-fluoro-6-pentylnaphthalene (PubChem CID 139860913) has the molecular formula C24H31F3O and a molecular weight of 392.51 g/mol. Its IUPAC name is 3-(difluoromethoxy)-2-(4-ethylcyclohexyl)-1-fluoro-6-pentylnaphthalene.
| Compound Name | 3-(difluoromethoxy)-2-(4-ethylcyclohexyl)-1-fluoro-6-pentylnaphthalene |
|---|---|
| PubChem CID | 139860913 |
| Molecular Formula | C24H31F3O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 3-(difluoromethoxy)-2-(4-ethylcyclohexyl)-1-fluoro-6-pentylnaphthalene |
| SMILES | CCCCCc1ccc2c(F)c(C3CCC(CC)CC3)c(OC(F)F)cc2c1 |
| InChI | InChI=1S/C24H31F3O/c1-3-5-6-7-17-10-13-20-19(14-17)15-21(28-24(26)27)22(23(20)25)18-11-8-16(4-2)9-12-18/h10,13-16,18,24H,3-9,11-12H2,1-2H3 |
| InChIKey | MIJBIPRBIRAOLJ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|