C24H30N4O2 — CID 139879146
2-[4-[(3-butan-2-yl-5-pentyl-1,2,4-triazol-1-yl)methyl]phenyl]pyridine-3-carboxylic acid (PubChem CID 139879146) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[4-[(3-butan-2-yl-5-pentyl-1,2,4-triazol-1-yl)methyl]phenyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[4-[(3-butan-2-yl-5-pentyl-1,2,4-triazol-1-yl)methyl]phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 139879146 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-[4-[(3-butan-2-yl-5-pentyl-1,2,4-triazol-1-yl)methyl]phenyl]pyridine-3-carboxylic acid |
| SMILES | CCCCCc1nc(C(C)CC)nn1Cc1ccc(-c2ncccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H30N4O2/c1-4-6-7-10-21-26-23(17(3)5-2)27-28(21)16-18-11-13-19(14-12-18)22-20(24(29)30)9-8-15-25-22/h8-9,11-15,17H,4-7,10,16H2,1-3H3,(H,29,30) |
| InChIKey | NSKUGCLWWDBXGZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|