C6H9F2N — CID 139880316
1-(2,2-difluoroethyl)-2,5-dihydropyrrole (PubChem CID 139880316) has the molecular formula C6H9F2N and a molecular weight of 133.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2,5-dihydropyrrole.
| Compound Name | 1-(2,2-difluoroethyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 139880316 |
| Molecular Formula | C6H9F2N |
| Molecular Weight | 133.14 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2,5-dihydropyrrole |
| SMILES | FC(F)CN1CC=CC1 |
| InChI | InChI=1S/C6H9F2N/c7-6(8)5-9-3-1-2-4-9/h1-2,6H,3-5H2 |
| InChIKey | FAMAIWQHTPRVLA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.14 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|