C7H13F3N+ — CID 135270741
trimethyl-[(Z)-3,4,4-trifluorobut-2-enyl]azanium (PubChem CID 135270741) has the molecular formula C7H13F3N+ and a molecular weight of 168.18 g/mol. Its IUPAC name is trimethyl-[(Z)-3,4,4-trifluorobut-2-enyl]azanium.
| Compound Name | trimethyl-[(Z)-3,4,4-trifluorobut-2-enyl]azanium |
|---|---|
| PubChem CID | 135270741 |
| Molecular Formula | C7H13F3N+ |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | trimethyl-[(Z)-3,4,4-trifluorobut-2-enyl]azanium |
| SMILES | C[N+](C)(C)C/C=C(\F)C(F)F |
| InChI | InChI=1S/C7H13F3N/c1-11(2,3)5-4-6(8)7(9)10/h4,7H,5H2,1-3H3/q+1/b6-4- |
| InChIKey | HAYBAFBCMBQPJX-XQRVVYSFSA-N |
| XLogP | 1.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|