C6H11F2N — CID 142984205
(Z)-2,3-difluoro-N,N-dimethylbut-2-en-1-amine (PubChem CID 142984205) has the molecular formula C6H11F2N and a molecular weight of 135.16 g/mol. Its IUPAC name is (Z)-2,3-difluoro-N,N-dimethylbut-2-en-1-amine.
| Compound Name | (Z)-2,3-difluoro-N,N-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 142984205 |
| Molecular Formula | C6H11F2N |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | (Z)-2,3-difluoro-N,N-dimethylbut-2-en-1-amine |
| SMILES | C/C(F)=C(/F)CN(C)C |
| InChI | InChI=1S/C6H11F2N/c1-5(7)6(8)4-9(2)3/h4H2,1-3H3/b6-5- |
| InChIKey | UEEXGECZMNANQH-WAYWQWQTSA-N |
| XLogP | 1.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |