C7H11F4N — CID 174465974
N,N-diethyl-1,2,3,3-tetrafluoroprop-2-en-1-amine (PubChem CID 174465974) has the molecular formula C7H11F4N and a molecular weight of 185.16 g/mol. Its IUPAC name is N,N-diethyl-1,2,3,3-tetrafluoroprop-2-en-1-amine.
| Compound Name | N,N-diethyl-1,2,3,3-tetrafluoroprop-2-en-1-amine |
|---|---|
| PubChem CID | 174465974 |
| Molecular Formula | C7H11F4N |
| Molecular Weight | 185.16 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | N,N-diethyl-1,2,3,3-tetrafluoroprop-2-en-1-amine |
| SMILES | CCN(CC)C(F)C(F)=C(F)F |
| InChI | InChI=1S/C7H11F4N/c1-3-12(4-2)7(11)5(8)6(9)10/h7H,3-4H2,1-2H3 |
| InChIKey | LDDZQRDJNGTIDL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|