C7H11F6N — CID 7158835
(2R)-N,N-diethyl-1,1,2,3,3,3-hexafluoropropan-1-amine (PubChem CID 7158835) has the molecular formula C7H11F6N and a molecular weight of 223.16 g/mol. Its IUPAC name is (2R)-N,N-diethyl-1,1,2,3,3,3-hexafluoropropan-1-amine.
| Compound Name | (2R)-N,N-diethyl-1,1,2,3,3,3-hexafluoropropan-1-amine |
|---|---|
| PubChem CID | 7158835 |
| Molecular Formula | C7H11F6N |
| Molecular Weight | 223.16 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (2R)-N,N-diethyl-1,1,2,3,3,3-hexafluoropropan-1-amine |
| SMILES | CCN(CC)C(F)(F)[C@@H](F)C(F)(F)F |
| InChI | InChI=1S/C7H11F6N/c1-3-14(4-2)7(12,13)5(8)6(9,10)11/h5H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | BNTFCVMJHBNJAR-YFKPBYRVSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.16 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|