C14H26O6S — CID 139881048
3-(1-carboxy-3-methylpentan-2-yl)sulfonyl-4-methylhexanoic acid (PubChem CID 139881048) has the molecular formula C14H26O6S and a molecular weight of 322.42 g/mol. Its IUPAC name is 3-(1-carboxy-3-methylpentan-2-yl)sulfonyl-4-methylhexanoic acid.
| Compound Name | 3-(1-carboxy-3-methylpentan-2-yl)sulfonyl-4-methylhexanoic acid |
|---|---|
| PubChem CID | 139881048 |
| Molecular Formula | C14H26O6S |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-(1-carboxy-3-methylpentan-2-yl)sulfonyl-4-methylhexanoic acid |
| SMILES | CCC(C)C(CC(=O)O)S(=O)(=O)C(CC(=O)O)C(C)CC |
| InChI | InChI=1S/C14H26O6S/c1-5-9(3)11(7-13(15)16)21(19,20)12(8-14(17)18)10(4)6-2/h9-12H,5-8H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | FNLMKTAAWHIVLF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |