C30H28ClNO5 — CID 139882902
3-[4-[2-[(1-chloro-4-phenylcyclohexa-2,4-diene-1-carbonyl)amino]ethoxy]phenyl]-2-phenoxypropanoic acid (PubChem CID 139882902) has the molecular formula C30H28ClNO5 and a molecular weight of 518.01 g/mol. Its IUPAC name is 3-[4-[2-[(1-chloro-4-phenylcyclohexa-2,4-diene-1-carbonyl)amino]ethoxy]phenyl]-2-phenoxypropanoic acid.
| Compound Name | 3-[4-[2-[(1-chloro-4-phenylcyclohexa-2,4-diene-1-carbonyl)amino]ethoxy]phenyl]-2-phenoxypropanoic acid |
|---|---|
| PubChem CID | 139882902 |
| Molecular Formula | C30H28ClNO5 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 3-[4-[2-[(1-chloro-4-phenylcyclohexa-2,4-diene-1-carbonyl)amino]ethoxy]phenyl]-2-phenoxypropanoic acid |
| SMILES | O=C(O)C(Cc1ccc(OCCNC(=O)C2(Cl)C=CC(c3ccccc3)=CC2)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C30H28ClNO5/c31-30(17-15-24(16-18-30)23-7-3-1-4-8-23)29(35)32-19-20-36-25-13-11-22(12-14-25)21-27(28(33)34)37-26-9-5-2-6-10-26/h1-17,27H,18-21H2,(H,32,35)(H,33,34) |
| InChIKey | CYLPPMZTADBLFQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|