C19H23NO8S2 — CID 139882997
[4-[methoxysulfonyloxy(dimethyl)-λ4-sulfanyl]phenyl] 2-(phenylmethoxycarbonylamino)acetate (PubChem CID 139882997) has the molecular formula C19H23NO8S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is [4-[methoxysulfonyloxy(dimethyl)-λ4-sulfanyl]phenyl] 2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | [4-[methoxysulfonyloxy(dimethyl)-λ4-sulfanyl]phenyl] 2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 139882997 |
| Molecular Formula | C19H23NO8S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | [4-[methoxysulfonyloxy(dimethyl)-λ4-sulfanyl]phenyl] 2-(phenylmethoxycarbonylamino)acetate |
| SMILES | COS(=O)(=O)OS(C)(C)c1ccc(OC(=O)CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO8S2/c1-25-30(23,24)28-29(2,3)17-11-9-16(10-12-17)27-18(21)13-20-19(22)26-14-15-7-5-4-6-8-15/h4-12H,13-14H2,1-3H3,(H,20,22) |
| InChIKey | BFAHGPJAVUGXBD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|