C22H19N3O3S — CID 139886659
4-[2-(4-prop-2-enoxyphenyl)pyrazolo[1,5-a]pyridin-3-yl]benzenesulfonamide (PubChem CID 139886659) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-[2-(4-prop-2-enoxyphenyl)pyrazolo[1,5-a]pyridin-3-yl]benzenesulfonamide.
| Compound Name | 4-[2-(4-prop-2-enoxyphenyl)pyrazolo[1,5-a]pyridin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 139886659 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 4-[2-(4-prop-2-enoxyphenyl)pyrazolo[1,5-a]pyridin-3-yl]benzenesulfonamide |
| SMILES | C=CCOc1ccc(-c2nn3ccccc3c2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-2-15-28-18-10-6-17(7-11-18)22-21(20-5-3-4-14-25(20)24-22)16-8-12-19(13-9-16)29(23,26)27/h2-14H,1,15H2,(H2,23,26,27) |
| InChIKey | LCGFRXPRONSOJS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|