C41H33N5O2S — CID 139886905
3-[4-(2,5-dimethylpyrrol-1-yl)sulfonylphenyl]-2-(1-tritylpyrazol-4-yl)pyrazolo[1,5-a]pyridine (PubChem CID 139886905) has the molecular formula C41H33N5O2S and a molecular weight of 659.82 g/mol. Its IUPAC name is 3-[4-(2,5-dimethylpyrrol-1-yl)sulfonylphenyl]-2-(1-tritylpyrazol-4-yl)pyrazolo[1,5-a]pyridine.
| Compound Name | 3-[4-(2,5-dimethylpyrrol-1-yl)sulfonylphenyl]-2-(1-tritylpyrazol-4-yl)pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 139886905 |
| Molecular Formula | C41H33N5O2S |
| Molecular Weight | 659.82 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | 3-[4-(2,5-dimethylpyrrol-1-yl)sulfonylphenyl]-2-(1-tritylpyrazol-4-yl)pyrazolo[1,5-a]pyridine |
| SMILES | Cc1ccc(C)n1S(=O)(=O)c1ccc(-c2c(-c3cnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3)nn3ccccc23)cc1 |
| InChI | InChI=1S/C41H33N5O2S/c1-30-21-22-31(2)46(30)49(47,48)37-25-23-32(24-26-37)39-38-20-12-13-27-44(38)43-40(39)33-28-42-45(29-33)41(34-14-6-3-7-15-34,35-16-8-4-9-17-35)36-18-10-5-11-19-36/h3-29H,1-2H3 |
| InChIKey | SPFGYSDHGOWXAZ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.82 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|