C19H12Cl6O5 — CID 139886973
5,5-bis(2,3,5-trichloro-4-hydroxyphenyl)-1,3-dioxaspiro[3.5]nonan-2-one (PubChem CID 139886973) has the molecular formula C19H12Cl6O5 and a molecular weight of 533.02 g/mol. Its IUPAC name is 5,5-bis(2,3,5-trichloro-4-hydroxyphenyl)-1,3-dioxaspiro[3.5]nonan-2-one.
| Compound Name | 5,5-bis(2,3,5-trichloro-4-hydroxyphenyl)-1,3-dioxaspiro[3.5]nonan-2-one |
|---|---|
| PubChem CID | 139886973 |
| Molecular Formula | C19H12Cl6O5 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 529.88 |
| IUPAC Name | 5,5-bis(2,3,5-trichloro-4-hydroxyphenyl)-1,3-dioxaspiro[3.5]nonan-2-one |
| SMILES | O=C1OC2(CCCCC2(c2cc(Cl)c(O)c(Cl)c2Cl)c2cc(Cl)c(O)c(Cl)c2Cl)O1 |
| InChI | InChI=1S/C19H12Cl6O5/c20-9-5-7(11(22)13(24)15(9)26)18(3-1-2-4-19(18)29-17(28)30-19)8-6-10(21)16(27)14(25)12(8)23/h5-6,26-27H,1-4H2 |
| InChIKey | XTAUCXVEHMPWSU-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|