C16H25Cl2N5S2 — CID 139887265
5-[3-[4-(3-methylphenyl)piperazin-1-yl]propylsulfanyl]-1,3,4-thiadiazol-2-amine;dihydrochloride (PubChem CID 139887265) has the molecular formula C16H25Cl2N5S2 and a molecular weight of 422.45 g/mol. Its IUPAC name is 5-[3-[4-(3-methylphenyl)piperazin-1-yl]propylsulfanyl]-1,3,4-thiadiazol-2-amine;dihydrochloride.
| Compound Name | 5-[3-[4-(3-methylphenyl)piperazin-1-yl]propylsulfanyl]-1,3,4-thiadiazol-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 139887265 |
| Molecular Formula | C16H25Cl2N5S2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 5-[3-[4-(3-methylphenyl)piperazin-1-yl]propylsulfanyl]-1,3,4-thiadiazol-2-amine;dihydrochloride |
| SMILES | Cc1cccc(N2CCN(CCCSc3nnc(N)s3)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C16H23N5S2.2ClH/c1-13-4-2-5-14(12-13)21-9-7-20(8-10-21)6-3-11-22-16-19-18-15(17)23-16;;/h2,4-5,12H,3,6-11H2,1H3,(H2,17,18);2*1H |
| InChIKey | UTTJXPBKZYPAOJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|