C29H41N3O2S — CID 139889293
N-[2-[4-[(1-adamantylmethylamino)methyl]piperidin-1-yl]ethyl]naphthalene-1-sulfonamide (PubChem CID 139889293) has the molecular formula C29H41N3O2S and a molecular weight of 495.73 g/mol. Its IUPAC name is N-[2-[4-[(1-adamantylmethylamino)methyl]piperidin-1-yl]ethyl]naphthalene-1-sulfonamide.
| Compound Name | N-[2-[4-[(1-adamantylmethylamino)methyl]piperidin-1-yl]ethyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 139889293 |
| Molecular Formula | C29H41N3O2S |
| Molecular Weight | 495.73 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-[2-[4-[(1-adamantylmethylamino)methyl]piperidin-1-yl]ethyl]naphthalene-1-sulfonamide |
| SMILES | O=S(=O)(NCCN1CCC(CNCC23CC4CC(CC(C4)C2)C3)CC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H41N3O2S/c33-35(34,28-7-3-5-26-4-1-2-6-27(26)28)31-10-13-32-11-8-22(9-12-32)20-30-21-29-17-23-14-24(18-29)16-25(15-23)19-29/h1-7,22-25,30-31H,8-21H2 |
| InChIKey | VBVWFVNKIMHVHQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.73 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |