C22H26F2 — CID 139890205
1-[4-(4-but-1-ynylcyclohexyl)cyclohexen-1-yl]-3,5-difluorobenzene (PubChem CID 139890205) has the molecular formula C22H26F2 and a molecular weight of 328.45 g/mol. Its IUPAC name is 1-[4-(4-but-1-ynylcyclohexyl)cyclohexen-1-yl]-3,5-difluorobenzene.
| Compound Name | 1-[4-(4-but-1-ynylcyclohexyl)cyclohexen-1-yl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 139890205 |
| Molecular Formula | C22H26F2 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-[4-(4-but-1-ynylcyclohexyl)cyclohexen-1-yl]-3,5-difluorobenzene |
| SMILES | CCC#CC1CCC(C2CC=C(c3cc(F)cc(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H26F2/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)20-13-21(23)15-22(24)14-20/h11,13-18H,2,5-10,12H2,1H3 |
| InChIKey | SYEYBZYQAXCJCX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|