C25H23F2N5OS2 — CID 139890414
(2R,3R)-2-(2,4-difluorophenyl)-3-[[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-2-yl]methylsulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 139890414) has the molecular formula C25H23F2N5OS2 and a molecular weight of 511.62 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-2-yl]methylsulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-2-yl]methylsulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 139890414 |
| Molecular Formula | C25H23F2N5OS2 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-2-yl]methylsulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | Cc1ccc(-c2cn3cc(CS[C@H](C)[C@](O)(Cn4cncn4)c4ccc(F)cc4F)sc3n2)cc1 |
| InChI | InChI=1S/C25H23F2N5OS2/c1-16-3-5-18(6-4-16)23-11-31-10-20(35-24(31)30-23)12-34-17(2)25(33,13-32-15-28-14-29-32)21-8-7-19(26)9-22(21)27/h3-11,14-15,17,33H,12-13H2,1-2H3/t17-,25-/m1/s1 |
| InChIKey | XTPHQRDLDAEMJL-CRICUBBOSA-N |
| XLogP | 5.45 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |