C19H19F2N5OS2 — CID 139890386
(2R,3R)-2-(2,4-difluorophenyl)-3-[(3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methylsulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 139890386) has the molecular formula C19H19F2N5OS2 and a molecular weight of 435.53 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[(3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methylsulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[(3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methylsulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 139890386 |
| Molecular Formula | C19H19F2N5OS2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[(3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methylsulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | Cc1c(CS[C@H](C)[C@](O)(Cn2cncn2)c2ccc(F)cc2F)sc2nccn12 |
| InChI | InChI=1S/C19H19F2N5OS2/c1-12-17(29-18-23-5-6-26(12)18)8-28-13(2)19(27,9-25-11-22-10-24-25)15-4-3-14(20)7-16(15)21/h3-7,10-11,13,27H,8-9H2,1-2H3/t13-,19-/m1/s1 |
| InChIKey | DIPIYKVAXXTBSZ-BFUOFWGJSA-N |
| XLogP | 3.78 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |