C17H20F2N4OS2 — CID 88524749
[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 88524749) has the molecular formula C17H20F2N4OS2 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 88524749 |
| Molecular Formula | C17H20F2N4OS2 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | C[C@@H](SC(=S)N1CCCC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H20F2N4OS2/c1-12(26-16(25)22-6-2-3-7-22)17(24,9-23-11-20-10-21-23)14-5-4-13(18)8-15(14)19/h4-5,8,10-12,24H,2-3,6-7,9H2,1H3/t12-,17-/m1/s1 |
| InChIKey | DZOKKXUZWXDFJE-SJKOYZFVSA-N |
| XLogP | 2.95 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|