C19H22F2N4OS — CID 87272417
3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-N,N-bis(prop-2-enyl)-4-(1,2,4-triazol-1-yl)butanethioamide (PubChem CID 87272417) has the molecular formula C19H22F2N4OS and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-N,N-bis(prop-2-enyl)-4-(1,2,4-triazol-1-yl)butanethioamide.
| Compound Name | 3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-N,N-bis(prop-2-enyl)-4-(1,2,4-triazol-1-yl)butanethioamide |
|---|---|
| PubChem CID | 87272417 |
| Molecular Formula | C19H22F2N4OS |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-N,N-bis(prop-2-enyl)-4-(1,2,4-triazol-1-yl)butanethioamide |
| SMILES | C=CCN(CC=C)C(=S)C(C)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H22F2N4OS/c1-4-8-24(9-5-2)18(27)14(3)19(26,11-25-13-22-12-23-25)16-7-6-15(20)10-17(16)21/h4-7,10,12-14,26H,1-2,8-9,11H2,3H3 |
| InChIKey | IXQAVYXAQZYFGC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|