C18H20F2N6OS3 — CID 139722338
(2R,3R)-2-(2,4-difluorophenyl)-3-[(4-thiomorpholin-4-yl-1,2,5-thiadiazol-3-yl)sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 139722338) has the molecular formula C18H20F2N6OS3 and a molecular weight of 470.60 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[(4-thiomorpholin-4-yl-1,2,5-thiadiazol-3-yl)sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[(4-thiomorpholin-4-yl-1,2,5-thiadiazol-3-yl)sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 139722338 |
| Molecular Formula | C18H20F2N6OS3 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[(4-thiomorpholin-4-yl-1,2,5-thiadiazol-3-yl)sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](Sc1nsnc1N1CCSCC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H20F2N6OS3/c1-12(29-17-16(23-30-24-17)25-4-6-28-7-5-25)18(27,9-26-11-21-10-22-26)14-3-2-13(19)8-15(14)20/h2-3,8,10-12,27H,4-7,9H2,1H3/t12-,18-/m1/s1 |
| InChIKey | UNMCCSBLTHEOCF-KZULUSFZSA-N |
| XLogP | 3.03 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |