C18H15F2N5OS3 — CID 139722311
(2R,3R)-2-(2,4-difluorophenyl)-3-[(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 139722311) has the molecular formula C18H15F2N5OS3 and a molecular weight of 451.55 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 139722311 |
| Molecular Formula | C18H15F2N5OS3 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](Sc1nc(-c2cccs2)ns1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H15F2N5OS3/c1-11(28-17-23-16(24-29-17)15-3-2-6-27-15)18(26,8-25-10-21-9-22-25)13-5-4-12(19)7-14(13)20/h2-7,9-11,26H,8H2,1H3/t11-,18-/m1/s1 |
| InChIKey | KHMAEELKLVPRGN-ADLMAVQZSA-N |
| XLogP | 4.20 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |