C21H21F2N7OS — CID 123698310
2-(2,4-difluorophenyl)-3-(2-thiophen-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 123698310) has the molecular formula C21H21F2N7OS and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-(2-thiophen-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-3-(2-thiophen-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 123698310 |
| Molecular Formula | C21H21F2N7OS |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-(2-thiophen-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC(N1CCn2nc(-c3cccs3)nc2C1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H21F2N7OS/c1-14(28-6-7-30-19(10-28)26-20(27-30)18-3-2-8-32-18)21(31,11-29-13-24-12-25-29)16-5-4-15(22)9-17(16)23/h2-5,8-9,12-14,31H,6-7,10-11H2,1H3 |
| InChIKey | HKJIRBQDXUPUPS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |