C22H22F2N8O — CID 123500732
2-(2,4-difluorophenyl)-3-(2-pyridin-4-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 123500732) has the molecular formula C22H22F2N8O and a molecular weight of 452.47 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-(2-pyridin-4-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-3-(2-pyridin-4-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 123500732 |
| Molecular Formula | C22H22F2N8O |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-(2-pyridin-4-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC(N1CCn2nc(-c3ccncc3)nc2C1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H22F2N8O/c1-15(22(33,12-31-14-26-13-27-31)18-3-2-17(23)10-19(18)24)30-8-9-32-20(11-30)28-21(29-32)16-4-6-25-7-5-16/h2-7,10,13-15,33H,8-9,11-12H2,1H3 |
| InChIKey | OMCLIKIJRCBKCS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |