C23H18Cl2F2N4OS2 — CID 139722312
(2R,3R)-3-[[4-[2-(2,3-dichlorophenyl)ethenyl]-1,3-thiazol-2-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 139722312) has the molecular formula C23H18Cl2F2N4OS2 and a molecular weight of 539.46 g/mol. Its IUPAC name is (2R,3R)-3-[[4-[2-(2,3-dichlorophenyl)ethenyl]-1,3-thiazol-2-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-3-[[4-[2-(2,3-dichlorophenyl)ethenyl]-1,3-thiazol-2-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 139722312 |
| Molecular Formula | C23H18Cl2F2N4OS2 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | (2R,3R)-3-[[4-[2-(2,3-dichlorophenyl)ethenyl]-1,3-thiazol-2-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](Sc1nc(C=Cc2cccc(Cl)c2Cl)cs1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H18Cl2F2N4OS2/c1-14(23(32,11-31-13-28-12-29-31)18-8-6-16(26)9-20(18)27)34-22-30-17(10-33-22)7-5-15-3-2-4-19(24)21(15)25/h2-10,12-14,32H,11H2,1H3/t14-,23-/m1/s1 |
| InChIKey | WWEBJQURAJHION-QKFKETGDSA-N |
| XLogP | 6.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |