C21H16F5N5OS2 — CID 67699570
(3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]sulfanyl]butan-2-ol (PubChem CID 67699570) has the molecular formula C21H16F5N5OS2 and a molecular weight of 513.52 g/mol. Its IUPAC name is (3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]sulfanyl]butan-2-ol.
| Compound Name | (3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]sulfanyl]butan-2-ol |
|---|---|
| PubChem CID | 67699570 |
| Molecular Formula | C21H16F5N5OS2 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | (3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]sulfanyl]butan-2-ol |
| SMILES | C[C@@H](Sc1nc(-c2cccc(C(F)(F)F)c2)ns1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H16F5N5OS2/c1-12(20(32,9-31-11-27-10-28-31)16-6-5-15(22)8-17(16)23)33-19-29-18(30-34-19)13-3-2-4-14(7-13)21(24,25)26/h2-8,10-12,32H,9H2,1H3/t12-,20?/m1/s1 |
| InChIKey | UYNUZVVVRQBSHE-ZRIYNBNISA-N |
| XLogP | 5.16 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |