C20H19N3O2 — CID 139892033
5-[2-(naphthalen-1-ylmethylamino)ethoxy]-1,3-dihydrobenzimidazol-2-one (PubChem CID 139892033) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 5-[2-(naphthalen-1-ylmethylamino)ethoxy]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[2-(naphthalen-1-ylmethylamino)ethoxy]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 139892033 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 5-[2-(naphthalen-1-ylmethylamino)ethoxy]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(OCCNCc3cccc4ccccc34)cc2[nH]1 |
| InChI | InChI=1S/C20H19N3O2/c24-20-22-18-9-8-16(12-19(18)23-20)25-11-10-21-13-15-6-3-5-14-4-1-2-7-17(14)15/h1-9,12,21H,10-11,13H2,(H2,22,23,24) |
| InChIKey | FHQBBZFVKIIEGL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|