C25H22F4N2O — CID 139892277
6-tert-butyl-2-[4-fluoro-3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]-1H-benzimidazole (PubChem CID 139892277) has the molecular formula C25H22F4N2O and a molecular weight of 442.46 g/mol. Its IUPAC name is 6-tert-butyl-2-[4-fluoro-3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]-1H-benzimidazole.
| Compound Name | 6-tert-butyl-2-[4-fluoro-3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 139892277 |
| Molecular Formula | C25H22F4N2O |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 6-tert-butyl-2-[4-fluoro-3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]-1H-benzimidazole |
| SMILES | CC(C)(C)c1ccc2nc(-c3ccc(F)c(OCc4ccccc4C(F)(F)F)c3)[nH]c2c1 |
| InChI | InChI=1S/C25H22F4N2O/c1-24(2,3)17-9-11-20-21(13-17)31-23(30-20)15-8-10-19(26)22(12-15)32-14-16-6-4-5-7-18(16)25(27,28)29/h4-13H,14H2,1-3H3,(H,30,31) |
| InChIKey | DIEQLRYUHKQLAD-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |