C23H27NO5 — CID 1398925
8-[(diethylazaniumyl)methyl]-3-(2-ethoxyphenoxy)-2-methyl-4-oxochromen-7-olate (PubChem CID 1398925) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 8-[(diethylazaniumyl)methyl]-3-(2-ethoxyphenoxy)-2-methyl-4-oxochromen-7-olate.
| Compound Name | 8-[(diethylazaniumyl)methyl]-3-(2-ethoxyphenoxy)-2-methyl-4-oxochromen-7-olate |
|---|---|
| PubChem CID | 1398925 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 8-[(diethylazaniumyl)methyl]-3-(2-ethoxyphenoxy)-2-methyl-4-oxochromen-7-olate |
| SMILES | CCOc1ccccc1Oc1c(C)oc2c(C[NH+](CC)CC)c([O-])ccc2c1=O |
| InChI | InChI=1S/C23H27NO5/c1-5-24(6-2)14-17-18(25)13-12-16-21(26)22(15(4)28-23(16)17)29-20-11-9-8-10-19(20)27-7-3/h8-13,25H,5-7,14H2,1-4H3 |
| InChIKey | HXSWXFPPGLCRAA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |