C17H21FO4S — CID 139894192
3-[2-(fluoromethyl)prop-2-enoxy]-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan (PubChem CID 139894192) has the molecular formula C17H21FO4S and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[2-(fluoromethyl)prop-2-enoxy]-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan.
| Compound Name | 3-[2-(fluoromethyl)prop-2-enoxy]-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan |
|---|---|
| PubChem CID | 139894192 |
| Molecular Formula | C17H21FO4S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[2-(fluoromethyl)prop-2-enoxy]-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan |
| SMILES | C=C(CF)COC1=C(c2ccc(S(C)(=O)=O)cc2)C(C)(C)OC1 |
| InChI | InChI=1S/C17H21FO4S/c1-12(9-18)10-21-15-11-22-17(2,3)16(15)13-5-7-14(8-6-13)23(4,19)20/h5-8H,1,9-11H2,2-4H3 |
| InChIKey | ZGJRQKWYOWJLMW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|