C33H35N3O3 — CID 139896079
(2R)-5-amino-2-[(2,2-diphenylacetyl)amino]-N-[(1S)-1-(4-phenoxyphenyl)ethyl]pentanamide (PubChem CID 139896079) has the molecular formula C33H35N3O3 and a molecular weight of 521.66 g/mol. Its IUPAC name is (2R)-5-amino-2-[(2,2-diphenylacetyl)amino]-N-[(1S)-1-(4-phenoxyphenyl)ethyl]pentanamide.
| Compound Name | (2R)-5-amino-2-[(2,2-diphenylacetyl)amino]-N-[(1S)-1-(4-phenoxyphenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 139896079 |
| Molecular Formula | C33H35N3O3 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | (2R)-5-amino-2-[(2,2-diphenylacetyl)amino]-N-[(1S)-1-(4-phenoxyphenyl)ethyl]pentanamide |
| SMILES | C[C@H](NC(=O)[C@@H](CCCN)NC(=O)C(c1ccccc1)c1ccccc1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C33H35N3O3/c1-24(25-19-21-29(22-20-25)39-28-16-9-4-10-17-28)35-32(37)30(18-11-23-34)36-33(38)31(26-12-5-2-6-13-26)27-14-7-3-8-15-27/h2-10,12-17,19-22,24,30-31H,11,18,23,34H2,1H3,(H,35,37)(H,36,38)/t24-,30+/m0/s1 |
| InChIKey | YBWWMSZZVYLKIF-QABMSTFYSA-N |
| XLogP | 5.71 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |