About (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride
(2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride (PubChem CID 141009399) has the molecular formula C19H26ClN3O2
and a molecular weight of 363.89 g/mol. Its IUPAC name is (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride.
Molecular Properties
| Compound Name | (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride |
| PubChem CID | 141009399 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride |
| SMILES | CC(N[C@@H](CCCN)C(N)=O)c1ccc(Oc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H25N3O2.ClH/c1-14(22-18(19(21)23)8-5-13-20)15-9-11-17(12-10-15)24-16-6-3-2-4-7-16;/h2-4,6-7,9-12,14,18,22H,5,8,13,20H2,1H3,(H2,21,23);1H/t14?,18-;/m0./s1 |
| InChIKey | NIIHPXGRYQKMNX-XYGCWZSBSA-N |
| XLogP | 3.14 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride?
The IUPAC name of (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride (CID 141009399) is (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride.
What is the SMILES notation for (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride?
The canonical SMILES for (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride is CC(N[C@@H](CCCN)C(N)=O)c1ccc(Oc2ccccc2)cc1.Cl.
What is the InChIKey of (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride?
The InChIKey is NIIHPXGRYQKMNX-XYGCWZSBSA-N. The full InChI is InChI=1S/C19H25N3O2.ClH/c1-14(22-18(19(21)23)8-5-13-20)15-9-11-17(12-10-15)24-16-6-3-2-4-7-16;/h2-4,6-7,9-12,14,18,22H,5,8,13,20H2,1H3,(H2,21,23);1H/t14?,18-;/m0./s1.
What are the key properties of (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride?
(2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride has a molecular weight of 363.89 g/mol, XLogP of 3.14, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-amino-2-[1-(4-phenoxyphenyl)ethylamino]pentanamide;hydrochloride is sourced from PubChem (CID 141009399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).