About (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane
(1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane (PubChem CID 139898319) has the molecular formula C22H48ClN
and a molecular weight of 362.09 g/mol. Its IUPAC name is (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane.
Molecular Properties
| Compound Name | (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane |
| PubChem CID | 139898319 |
| Molecular Formula | C22H48ClN |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 361.35 |
| IUPAC Name | (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane |
| SMILES | CC(C)CCCCCCC(Cl)[NH+](C)C.[CH2-]CCCCCCC(C)C |
| InChI | InChI=1S/C12H26ClN.C10H21/c1-11(2)9-7-5-6-8-10-12(13)14(3)4;1-4-5-6-7-8-9-10(2)3/h11-12H,5-10H2,1-4H3;10H,1,4-9H2,2-3H3/q;-1/p+1 |
| InChIKey | YFRDUVLYTCRVCB-UHFFFAOYSA-O |
| XLogP | 6.51 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane?
The IUPAC name of (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane (CID 139898319) is (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane.
What is the SMILES notation for (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane?
The canonical SMILES for (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane is CC(C)CCCCCCC(Cl)[NH+](C)C.[CH2-]CCCCCCC(C)C.
What is the InChIKey of (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane?
The InChIKey is YFRDUVLYTCRVCB-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H26ClN.C10H21/c1-11(2)9-7-5-6-8-10-12(13)14(3)4;1-4-5-6-7-8-9-10(2)3/h11-12H,5-10H2,1-4H3;10H,1,4-9H2,2-3H3/q;-1/p+1.
What are the key properties of (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane?
(1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane has a molecular weight of 362.09 g/mol, XLogP of 6.51, 14 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1-chloro-8-methylnonyl)-dimethylazanium;2-methylnonane is sourced from PubChem (CID 139898319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).