C8H9N3O3S — CID 139899360
2H-1,2,3-benzotriazin-3-yl methanesulfonate (PubChem CID 139899360) has the molecular formula C8H9N3O3S and a molecular weight of 227.25 g/mol. Its IUPAC name is 2H-1,2,3-benzotriazin-3-yl methanesulfonate.
| Compound Name | 2H-1,2,3-benzotriazin-3-yl methanesulfonate |
|---|---|
| PubChem CID | 139899360 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2H-1,2,3-benzotriazin-3-yl methanesulfonate |
| SMILES | CS(=O)(=O)ON1C=c2ccccc2=NN1 |
| InChI | InChI=1S/C8H9N3O3S/c1-15(12,13)14-11-6-7-4-2-3-5-8(7)9-10-11/h2-6,10H,1H3 |
| InChIKey | WYSQJIZOUYMPRQ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |