About [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate
[2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate (PubChem CID 14570061) has the molecular formula C13H12F3NO5S
and a molecular weight of 351.30 g/mol. Its IUPAC name is [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate.
Molecular Properties
| Compound Name | [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate |
| PubChem CID | 14570061 |
| Molecular Formula | C13H12F3NO5S |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate |
| SMILES | CS(=O)(=O)ON1C(=O)CC(Cc2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C13H12F3NO5S/c1-23(20,21)22-17-11(18)7-9(12(17)19)6-8-4-2-3-5-10(8)13(14,15)16/h2-5,9H,6-7H2,1H3 |
| InChIKey | YWRDYXVVMDOZEH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate?
The IUPAC name of [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate (CID 14570061) is [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate.
What is the SMILES notation for [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate?
The canonical SMILES for [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate is CS(=O)(=O)ON1C(=O)CC(Cc2ccccc2C(F)(F)F)C1=O.
What is the InChIKey of [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate?
The InChIKey is YWRDYXVVMDOZEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3NO5S/c1-23(20,21)22-17-11(18)7-9(12(17)19)6-8-4-2-3-5-10(8)13(14,15)16/h2-5,9H,6-7H2,1H3.
What are the key properties of [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate?
[2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate has a molecular weight of 351.30 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-dioxo-3-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl] methanesulfonate is sourced from PubChem (CID 14570061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).