C11H22O2 — CID 139899444
9-hydroxy-4,7-dimethylnonan-3-one (PubChem CID 139899444) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 9-hydroxy-4,7-dimethylnonan-3-one.
| Compound Name | 9-hydroxy-4,7-dimethylnonan-3-one |
|---|---|
| PubChem CID | 139899444 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 9-hydroxy-4,7-dimethylnonan-3-one |
| SMILES | CCC(=O)C(C)CCC(C)CCO |
| InChI | InChI=1S/C11H22O2/c1-4-11(13)10(3)6-5-9(2)7-8-12/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | QPEYPUMZMCLOAI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |