C13H27NO2 — CID 143260657
10-amino-8-hydroxy-4,8-dimethylundecan-3-one (PubChem CID 143260657) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 10-amino-8-hydroxy-4,8-dimethylundecan-3-one.
| Compound Name | 10-amino-8-hydroxy-4,8-dimethylundecan-3-one |
|---|---|
| PubChem CID | 143260657 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 10-amino-8-hydroxy-4,8-dimethylundecan-3-one |
| SMILES | CCC(=O)C(C)CCCC(C)(O)CC(C)N |
| InChI | InChI=1S/C13H27NO2/c1-5-12(15)10(2)7-6-8-13(4,16)9-11(3)14/h10-11,16H,5-9,14H2,1-4H3 |
| InChIKey | XOWJXXBEEZRMNZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |