C12H18ClNO — CID 139899883
1-(4-chlorophenoxy)-N,2,2-trimethylpropan-1-amine (PubChem CID 139899883) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-N,2,2-trimethylpropan-1-amine.
| Compound Name | 1-(4-chlorophenoxy)-N,2,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 139899883 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-(4-chlorophenoxy)-N,2,2-trimethylpropan-1-amine |
| SMILES | CNC(Oc1ccc(Cl)cc1)C(C)(C)C |
| InChI | InChI=1S/C12H18ClNO/c1-12(2,3)11(14-4)15-10-7-5-9(13)6-8-10/h5-8,11,14H,1-4H3 |
| InChIKey | GNXXMSXCKKDMAG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|